C19H27NO4S — CID 159851374
2,3-dihydro-1H-inden-5-amine;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid (PubChem CID 159851374) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-amine;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid.
| Compound Name | 2,3-dihydro-1H-inden-5-amine;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
|---|---|
| PubChem CID | 159851374 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-amine;(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H16O4S.C9H11N/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;10-9-5-4-7-2-1-3-8(7)6-9/h7H,3-6H2,1-2H3,(H,12,13,14);4-6H,1-3,10H2 |
| InChIKey | NPZDPHQTJKTEPS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|