About 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone
2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone (PubChem CID 159853462) has the molecular formula C18H18N4O3
and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone.
Molecular Properties
| Compound Name | 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone |
| PubChem CID | 159853462 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone |
| SMILES | Cc1ncc(-c2ccc3cnc(CC(=O)N4CCOCC4)nc3c2)o1 |
| InChI | InChI=1S/C18H18N4O3/c1-12-19-11-16(25-12)13-2-3-14-10-20-17(21-15(14)8-13)9-18(23)22-4-6-24-7-5-22/h2-3,8,10-11H,4-7,9H2,1H3 |
| InChIKey | NQFSCRGEECJGPP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone?
The IUPAC name of 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone (CID 159853462) is 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone.
What is the SMILES notation for 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone?
The canonical SMILES for 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone is Cc1ncc(-c2ccc3cnc(CC(=O)N4CCOCC4)nc3c2)o1.
What is the InChIKey of 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone?
The InChIKey is NQFSCRGEECJGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3/c1-12-19-11-16(25-12)13-2-3-14-10-20-17(21-15(14)8-13)9-18(23)22-4-6-24-7-5-22/h2-3,8,10-11H,4-7,9H2,1H3.
What are the key properties of 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone?
2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone has a molecular weight of 338.37 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-(2-methyl-1,3-oxazol-5-yl)quinazolin-2-yl]-1-morpholin-4-ylethanone is sourced from PubChem (CID 159853462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).