About 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde
5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde (PubChem CID 159853654) has the molecular formula C9H8Br2N2OS2
and a molecular weight of 384.12 g/mol. Its IUPAC name is 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 159853654 |
| Molecular Formula | C9H8Br2N2OS2 |
| Molecular Weight | 384.12 g/mol |
| Exact Mass | 381.84 |
| IUPAC Name | 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(Br)c(C=O)s1.Cc1ncc(Br)s1 |
| InChI | InChI=1S/C5H4BrNOS.C4H4BrNS/c1-3-7-5(6)4(2-8)9-3;1-3-6-2-4(5)7-3/h2H,1H3;2H,1H3 |
| InChIKey | NQGGBCPNZLUXOE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.12 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde (CID 159853654) is 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde is Cc1nc(Br)c(C=O)s1.Cc1ncc(Br)s1.
What is the InChIKey of 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde?
The InChIKey is NQGGBCPNZLUXOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrNOS.C4H4BrNS/c1-3-7-5(6)4(2-8)9-3;1-3-6-2-4(5)7-3/h2H,1H3;2H,1H3.
What are the key properties of 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde?
5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde has a molecular weight of 384.12 g/mol, XLogP of 4.24, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-1,3-thiazole;4-bromo-2-methyl-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 159853654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).