C26H44O2Si — CID 159853778
(1S,4S,8R,9R,10S,11R,13R)-9-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,12-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-2,6-dien-4-ol (PubChem CID 159853778) has the molecular formula C26H44O2Si and a molecular weight of 416.72 g/mol. Its IUPAC name is (1S,4S,8R,9R,10S,11R,13R)-9-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,12-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-2,6-dien-4-ol.
| Compound Name | (1S,4S,8R,9R,10S,11R,13R)-9-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,12-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-2,6-dien-4-ol |
|---|---|
| PubChem CID | 159853778 |
| Molecular Formula | C26H44O2Si |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (1S,4S,8R,9R,10S,11R,13R)-9-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,12-pentamethyltetracyclo[8.5.0.02,6.011,13]pentadeca-2,6-dien-4-ol |
| SMILES | C[C@@H]1C=C2C[C@](C)(O)C=C2[C@@]2(C)CC[C@@H]3[C@H]([C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C)C3(C)C |
| InChI | InChI=1S/C26H44O2Si/c1-16-13-17-14-25(7,27)15-19(17)26(8)12-11-18-20(24(18,5)6)21(26)22(16)28-29(9,10)23(2,3)4/h13,15-16,18,20-22,27H,11-12,14H2,1-10H3/t16-,18-,20-,21-,22-,25+,26-/m1/s1 |
| InChIKey | NNRCVTGLNOFXDX-DKGCDBBKSA-N |
| XLogP | 6.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|