C23H24ClF3N2O6 — CID 159853824
1-(6-chloro-4-hydroxy-3,4-dihydro-2H-chromen-2-yl)-2-[(3S,6S)-6-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]oxan-3-yl]ethanone (PubChem CID 159853824) has the molecular formula C23H24ClF3N2O6 and a molecular weight of 516.90 g/mol. Its IUPAC name is 1-(6-chloro-4-hydroxy-3,4-dihydro-2H-chromen-2-yl)-2-[(3S,6S)-6-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]oxan-3-yl]ethanone.
| Compound Name | 1-(6-chloro-4-hydroxy-3,4-dihydro-2H-chromen-2-yl)-2-[(3S,6S)-6-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]oxan-3-yl]ethanone |
|---|---|
| PubChem CID | 159853824 |
| Molecular Formula | C23H24ClF3N2O6 |
| Molecular Weight | 516.90 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 1-(6-chloro-4-hydroxy-3,4-dihydro-2H-chromen-2-yl)-2-[(3S,6S)-6-[5-[3-(trifluoromethoxy)cyclobutyl]-1,3,4-oxadiazol-2-yl]oxan-3-yl]ethanone |
| SMILES | O=C(C[C@@H]1CC[C@@H](c2nnc(C3CC(OC(F)(F)F)C3)o2)OC1)C1CC(O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C23H24ClF3N2O6/c24-13-2-4-18-15(8-13)16(30)9-20(33-18)17(31)5-11-1-3-19(32-10-11)22-29-28-21(34-22)12-6-14(7-12)35-23(25,26)27/h2,4,8,11-12,14,16,19-20,30H,1,3,5-7,9-10H2/t11-,12?,14?,16?,19-,20?/m0/s1 |
| InChIKey | NQGSWFTUGNDMDL-XPGFRJOZSA-N |
| XLogP | 4.82 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.90 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |