About chloroform;ethanol;ethoxycarbonyl ethyl carbonate
chloroform;ethanol;ethoxycarbonyl ethyl carbonate (PubChem CID 159854698) has the molecular formula C9H17Cl3O6
and a molecular weight of 327.59 g/mol. Its IUPAC name is chloroform;ethanol;ethoxycarbonyl ethyl carbonate.
Molecular Properties
| Compound Name | chloroform;ethanol;ethoxycarbonyl ethyl carbonate |
| PubChem CID | 159854698 |
| Molecular Formula | C9H17Cl3O6 |
| Molecular Weight | 327.59 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | chloroform;ethanol;ethoxycarbonyl ethyl carbonate |
| SMILES | CCO.CCOC(=O)OC(=O)OCC.ClC(Cl)Cl |
| InChI | InChI=1S/C6H10O5.C2H6O.CHCl3/c1-3-9-5(7)11-6(8)10-4-2;1-2-3;2-1(3)4/h3-4H2,1-2H3;3H,2H2,1H3;1H |
| InChIKey | NQJLCOXMFVLMTK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze chloroform;ethanol;ethoxycarbonyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;ethanol;ethoxycarbonyl ethyl carbonate?
The IUPAC name of chloroform;ethanol;ethoxycarbonyl ethyl carbonate (CID 159854698) is chloroform;ethanol;ethoxycarbonyl ethyl carbonate.
What is the SMILES notation for chloroform;ethanol;ethoxycarbonyl ethyl carbonate?
The canonical SMILES for chloroform;ethanol;ethoxycarbonyl ethyl carbonate is CCO.CCOC(=O)OC(=O)OCC.ClC(Cl)Cl.
What is the InChIKey of chloroform;ethanol;ethoxycarbonyl ethyl carbonate?
The InChIKey is NQJLCOXMFVLMTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5.C2H6O.CHCl3/c1-3-9-5(7)11-6(8)10-4-2;1-2-3;2-1(3)4/h3-4H2,1-2H3;3H,2H2,1H3;1H.
What are the key properties of chloroform;ethanol;ethoxycarbonyl ethyl carbonate?
chloroform;ethanol;ethoxycarbonyl ethyl carbonate has a molecular weight of 327.59 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;ethanol;ethoxycarbonyl ethyl carbonate is sourced from PubChem (CID 159854698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).