C25H26FN7O4 — CID 159855604
1-fluoro-2-methyl-4-nitrobenzene;4-methyl-2-[(2-methyl-4-nitrophenyl)methyl]pyrimidine;4-methylpyrimidin-2-amine (PubChem CID 159855604) has the molecular formula C25H26FN7O4 and a molecular weight of 507.53 g/mol. Its IUPAC name is 1-fluoro-2-methyl-4-nitrobenzene;4-methyl-2-[(2-methyl-4-nitrophenyl)methyl]pyrimidine;4-methylpyrimidin-2-amine.
| Compound Name | 1-fluoro-2-methyl-4-nitrobenzene;4-methyl-2-[(2-methyl-4-nitrophenyl)methyl]pyrimidine;4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 159855604 |
| Molecular Formula | C25H26FN7O4 |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 1-fluoro-2-methyl-4-nitrobenzene;4-methyl-2-[(2-methyl-4-nitrophenyl)methyl]pyrimidine;4-methylpyrimidin-2-amine |
| SMILES | Cc1cc([N+](=O)[O-])ccc1F.Cc1ccnc(Cc2ccc([N+](=O)[O-])cc2C)n1.Cc1ccnc(N)n1 |
| InChI | InChI=1S/C13H13N3O2.C7H6FNO2.C5H7N3/c1-9-7-12(16(17)18)4-3-11(9)8-13-14-6-5-10(2)15-13;1-5-4-6(9(10)11)2-3-7(5)8;1-4-2-3-7-5(6)8-4/h3-7H,8H2,1-2H3;2-4H,1H3;2-3H,1H3,(H2,6,7,8) |
| InChIKey | NQMIJTXINRGEQW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|