About (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine
(E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine (PubChem CID 159855754) has the molecular formula C14H32N2O
and a molecular weight of 244.42 g/mol. Its IUPAC name is (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine.
Molecular Properties
| Compound Name | (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine |
| PubChem CID | 159855754 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine |
| SMILES | CC(C)(C)/C=C/CNC(C)(C)C.CCONC |
| InChI | InChI=1S/C11H23N.C3H9NO/c1-10(2,3)8-7-9-12-11(4,5)6;1-3-5-4-2/h7-8,12H,9H2,1-6H3;4H,3H2,1-2H3/b8-7+; |
| InChIKey | NQMVDLOCDKIRCS-USRGLUTNSA-N |
| XLogP | 3.13 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine?
The IUPAC name of (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine (CID 159855754) is (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine.
What is the SMILES notation for (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine?
The canonical SMILES for (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine is CC(C)(C)/C=C/CNC(C)(C)C.CCONC.
What is the InChIKey of (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine?
The InChIKey is NQMVDLOCDKIRCS-USRGLUTNSA-N. The full InChI is InChI=1S/C11H23N.C3H9NO/c1-10(2,3)8-7-9-12-11(4,5)6;1-3-5-4-2/h7-8,12H,9H2,1-6H3;4H,3H2,1-2H3/b8-7+;.
What are the key properties of (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine?
(E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine has a molecular weight of 244.42 g/mol, XLogP of 3.13, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-tert-butyl-4,4-dimethylpent-2-en-1-amine;N-ethoxymethanamine is sourced from PubChem (CID 159855754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).