About CID 159856008
CID 159856008 (PubChem CID 159856008) has the molecular formula C20H17BkN3
and a molecular weight of 546.38 g/mol.
Molecular Properties
| Compound Name | CID 159856008 |
| PubChem CID | 159856008 |
| Molecular Formula | C20H17BkN3 |
| Molecular Weight | 546.38 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | — |
| SMILES | Cc1[c-]ccc2c1-[n+]1c(nc3ccc4ccc(C)n(C)c4c31)C2.[Bk] |
| InChI | InChI=1S/C20H17N3.Bk/c1-12-5-4-6-15-11-17-21-16-10-9-14-8-7-13(2)22(3)19(14)20(16)23(17)18(12)15;/h4,6-10H,11H2,1-3H3; |
| InChIKey | NQNOZMILPMBKJM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 159856008 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159856008?
The IUPAC name of CID 159856008 (CID 159856008) is not available.
What is the SMILES notation for CID 159856008?
The canonical SMILES for CID 159856008 is Cc1[c-]ccc2c1-[n+]1c(nc3ccc4ccc(C)n(C)c4c31)C2.[Bk].
What is the InChIKey of CID 159856008?
The InChIKey is NQNOZMILPMBKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3.Bk/c1-12-5-4-6-15-11-17-21-16-10-9-14-8-7-13(2)22(3)19(14)20(16)23(17)18(12)15;/h4,6-10H,11H2,1-3H3;.
What are the key properties of CID 159856008?
CID 159856008 has a molecular weight of 546.38 g/mol, XLogP of 3.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159856008 is sourced from PubChem (CID 159856008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).