C26H36F2N3O7P — CID 15985660
[2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-6-fluoro-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] dihydrogen phosphate (PubChem CID 15985660) has the molecular formula C26H36F2N3O7P and a molecular weight of 571.56 g/mol. Its IUPAC name is [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-6-fluoro-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] dihydrogen phosphate.
| Compound Name | [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-6-fluoro-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 15985660 |
| Molecular Formula | C26H36F2N3O7P |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | [2-[3-[4-(2-cyclopentyloxy-5-fluorophenyl)piperazin-1-yl]propyl]-6-fluoro-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-5-yl] dihydrogen phosphate |
| SMILES | O=C1C2CC(F)C(OP(=O)(O)O)CC2C(=O)N1CCCN1CCN(c2cc(F)ccc2OC2CCCC2)CC1 |
| InChI | InChI=1S/C26H36F2N3O7P/c27-17-6-7-23(37-18-4-1-2-5-18)22(14-17)30-12-10-29(11-13-30)8-3-9-31-25(32)19-15-21(28)24(38-39(34,35)36)16-20(19)26(31)33/h6-7,14,18-21,24H,1-5,8-13,15-16H2,(H2,34,35,36) |
| InChIKey | DXGWRJRMGMFZEQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|