C18H20N2O7S — CID 159856856
[2,3,4-trihydroxy-5-[2-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]phenoxy]cyclohexyl] formate (PubChem CID 159856856) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is [2,3,4-trihydroxy-5-[2-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]phenoxy]cyclohexyl] formate.
| Compound Name | [2,3,4-trihydroxy-5-[2-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]phenoxy]cyclohexyl] formate |
|---|---|
| PubChem CID | 159856856 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | [2,3,4-trihydroxy-5-[2-[(5-methyl-1,3-thiazol-2-yl)carbamoyl]phenoxy]cyclohexyl] formate |
| SMILES | Cc1cnc(NC(=O)c2ccccc2OC2CC(OC=O)C(O)C(O)C2O)s1 |
| InChI | InChI=1S/C18H20N2O7S/c1-9-7-19-18(28-9)20-17(25)10-4-2-3-5-11(10)27-13-6-12(26-8-21)14(22)16(24)15(13)23/h2-5,7-8,12-16,22-24H,6H2,1H3,(H,19,20,25) |
| InChIKey | MMGIOBRSHAAQLU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|