C8H6BF2O8- — CID 159857892
3,9-difluoro-3,9-dimethyl-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecane-2,4,8,10-tetrone (PubChem CID 159857892) has the molecular formula C8H6BF2O8- and a molecular weight of 278.94 g/mol. Its IUPAC name is 3,9-difluoro-3,9-dimethyl-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecane-2,4,8,10-tetrone.
| Compound Name | 3,9-difluoro-3,9-dimethyl-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecane-2,4,8,10-tetrone |
|---|---|
| PubChem CID | 159857892 |
| Molecular Formula | C8H6BF2O8- |
| Molecular Weight | 278.94 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 3,9-difluoro-3,9-dimethyl-1,5,7,11-tetraoxa-6-boranuidaspiro[5.5]undecane-2,4,8,10-tetrone |
| SMILES | CC1(F)C(=O)O[B-]2(OC1=O)OC(=O)C(C)(F)C(=O)O2 |
| InChI | InChI=1S/C8H6BF2O8/c1-7(10)3(12)16-9(17-4(7)13)18-5(14)8(2,11)6(15)19-9/h1-2H3/q-1 |
| InChIKey | WZOOAVKSFFADEE-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.94 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|