About 3,6-dibromobenzene-1,2-diamine
3,6-dibromobenzene-1,2-diamine (PubChem CID 159857959) has the molecular formula C12H12Br4N4
and a molecular weight of 531.87 g/mol. Its IUPAC name is 3,6-dibromobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 3,6-dibromobenzene-1,2-diamine |
| PubChem CID | 159857959 |
| Molecular Formula | C12H12Br4N4 |
| Molecular Weight | 531.87 g/mol |
| Exact Mass | 527.78 |
| IUPAC Name | 3,6-dibromobenzene-1,2-diamine |
| SMILES | Nc1c(Br)ccc(Br)c1N.Nc1c(Br)ccc(Br)c1N |
| InChI | InChI=1S/2C6H6Br2N2/c2*7-3-1-2-4(8)6(10)5(3)9/h2*1-2H,9-10H2 |
| InChIKey | NQTRUSXJUIOCFP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.87 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dibromobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dibromobenzene-1,2-diamine?
The IUPAC name of 3,6-dibromobenzene-1,2-diamine (CID 159857959) is 3,6-dibromobenzene-1,2-diamine.
What is the SMILES notation for 3,6-dibromobenzene-1,2-diamine?
The canonical SMILES for 3,6-dibromobenzene-1,2-diamine is Nc1c(Br)ccc(Br)c1N.Nc1c(Br)ccc(Br)c1N.
What is the InChIKey of 3,6-dibromobenzene-1,2-diamine?
The InChIKey is NQTRUSXJUIOCFP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6Br2N2/c2*7-3-1-2-4(8)6(10)5(3)9/h2*1-2H,9-10H2.
What are the key properties of 3,6-dibromobenzene-1,2-diamine?
3,6-dibromobenzene-1,2-diamine has a molecular weight of 531.87 g/mol, XLogP of 4.75, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dibromobenzene-1,2-diamine is sourced from PubChem (CID 159857959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).