About chloro(dimethyl)silane;dimethylsilane
chloro(dimethyl)silane;dimethylsilane (PubChem CID 159857978) has the molecular formula C4H15ClSi2
and a molecular weight of 154.79 g/mol. Its IUPAC name is chloro(dimethyl)silane;dimethylsilane.
Molecular Properties
| Compound Name | chloro(dimethyl)silane;dimethylsilane |
| PubChem CID | 159857978 |
| Molecular Formula | C4H15ClSi2 |
| Molecular Weight | 154.79 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | chloro(dimethyl)silane;dimethylsilane |
| SMILES | C[SiH2]C.C[SiH](C)Cl |
| InChI | InChI=1S/C2H7ClSi.C2H8Si/c1-4(2)3;1-3-2/h4H,1-2H3;3H2,1-2H3 |
| InChIKey | NQTUBYZMOWNUFB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro(dimethyl)silane;dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(dimethyl)silane;dimethylsilane?
The IUPAC name of chloro(dimethyl)silane;dimethylsilane (CID 159857978) is chloro(dimethyl)silane;dimethylsilane.
What is the SMILES notation for chloro(dimethyl)silane;dimethylsilane?
The canonical SMILES for chloro(dimethyl)silane;dimethylsilane is C[SiH2]C.C[SiH](C)Cl.
What is the InChIKey of chloro(dimethyl)silane;dimethylsilane?
The InChIKey is NQTUBYZMOWNUFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7ClSi.C2H8Si/c1-4(2)3;1-3-2/h4H,1-2H3;3H2,1-2H3.
What are the key properties of chloro(dimethyl)silane;dimethylsilane?
chloro(dimethyl)silane;dimethylsilane has a molecular weight of 154.79 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(dimethyl)silane;dimethylsilane is sourced from PubChem (CID 159857978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).