C28H38FN3O9 — CID 15985844
(Z)-but-2-enedioic acid;2-[3-[4-(5-fluoro-2-propoxyphenyl)piperazin-1-yl]propyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 15985844) has the molecular formula C28H38FN3O9 and a molecular weight of 579.62 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[3-[4-(5-fluoro-2-propoxyphenyl)piperazin-1-yl]propyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (Z)-but-2-enedioic acid;2-[3-[4-(5-fluoro-2-propoxyphenyl)piperazin-1-yl]propyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 15985844 |
| Molecular Formula | C28H38FN3O9 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[3-[4-(5-fluoro-2-propoxyphenyl)piperazin-1-yl]propyl]-5,6-dihydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CCCOc1ccc(F)cc1N1CCN(CCCN2C(=O)C3CC(O)C(O)CC3C2=O)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H34FN3O5.C4H4O4/c1-2-12-33-22-5-4-16(25)13-19(22)27-10-8-26(9-11-27)6-3-7-28-23(31)17-14-20(29)21(30)15-18(17)24(28)32;5-3(6)1-2-4(7)8/h4-5,13,17-18,20-21,29-30H,2-3,6-12,14-15H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QPTFEVGKJGBWMK-BTJKTKAUSA-N |
| XLogP | 0.96 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|