C19H19NO4S — CID 159858709
3-[(E)-4-hydroxy-3-oxobut-1-enyl]-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide (PubChem CID 159858709) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-[(E)-4-hydroxy-3-oxobut-1-enyl]-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide.
| Compound Name | 3-[(E)-4-hydroxy-3-oxobut-1-enyl]-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 159858709 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 3-[(E)-4-hydroxy-3-oxobut-1-enyl]-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide |
| SMILES | O=C(/C=C/c1cccc(S(=O)(=O)NC/C=C/c2ccccc2)c1)CO |
| InChI | InChI=1S/C19H19NO4S/c21-15-18(22)12-11-17-8-4-10-19(14-17)25(23,24)20-13-5-9-16-6-2-1-3-7-16/h1-12,14,20-21H,13,15H2/b9-5+,12-11+ |
| InChIKey | ZIGWRWZUHQHTMO-LCXVDEDSSA-N |
| XLogP | 2.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|