About 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane
8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane (PubChem CID 159859261) has the molecular formula C20H16Br2Cl3N5O
and a molecular weight of 608.55 g/mol. Its IUPAC name is 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane.
Molecular Properties
| Compound Name | 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane |
| PubChem CID | 159859261 |
| Molecular Formula | C20H16Br2Cl3N5O |
| Molecular Weight | 608.55 g/mol |
| Exact Mass | 604.88 |
| IUPAC Name | 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane |
| SMILES | C1CCOC1.Clc1nc(Cl)c2cccc(Br)c2n1.Nc1nc(Cl)nc2c(Br)cccc12 |
| InChI | InChI=1S/C8H3BrCl2N2.C8H5BrClN3.C4H8O/c9-5-3-1-2-4-6(5)12-8(11)13-7(4)10;9-5-3-1-2-4-6(5)12-8(10)13-7(4)11;1-2-4-5-3-1/h1-3H;1-3H,(H2,11,12,13);1-4H2 |
| InChIKey | NQXQTNXLBRHASV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.55 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane?
The IUPAC name of 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane (CID 159859261) is 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane.
What is the SMILES notation for 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane?
The canonical SMILES for 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane is C1CCOC1.Clc1nc(Cl)c2cccc(Br)c2n1.Nc1nc(Cl)nc2c(Br)cccc12.
What is the InChIKey of 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane?
The InChIKey is NQXQTNXLBRHASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrCl2N2.C8H5BrClN3.C4H8O/c9-5-3-1-2-4-6(5)12-8(11)13-7(4)10;9-5-3-1-2-4-6(5)12-8(10)13-7(4)11;1-2-4-5-3-1/h1-3H;1-3H,(H2,11,12,13);1-4H2.
What are the key properties of 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane?
8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane has a molecular weight of 608.55 g/mol, XLogP of 7.12, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2-chloroquinazolin-4-amine;8-bromo-2,4-dichloroquinazoline;oxolane is sourced from PubChem (CID 159859261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).