C20H18F4N2O2 — CID 159860815
5-[4-(1-fluoroethoxy)-3-methylphenyl]-2,3-dimethyl-5-(3,4,5-trifluorophenyl)imidazol-4-one (PubChem CID 159860815) has the molecular formula C20H18F4N2O2 and a molecular weight of 394.37 g/mol. Its IUPAC name is 5-[4-(1-fluoroethoxy)-3-methylphenyl]-2,3-dimethyl-5-(3,4,5-trifluorophenyl)imidazol-4-one.
| Compound Name | 5-[4-(1-fluoroethoxy)-3-methylphenyl]-2,3-dimethyl-5-(3,4,5-trifluorophenyl)imidazol-4-one |
|---|---|
| PubChem CID | 159860815 |
| Molecular Formula | C20H18F4N2O2 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 5-[4-(1-fluoroethoxy)-3-methylphenyl]-2,3-dimethyl-5-(3,4,5-trifluorophenyl)imidazol-4-one |
| SMILES | CC1=NC(c2ccc(OC(C)F)c(C)c2)(c2cc(F)c(F)c(F)c2)C(=O)N1C |
| InChI | InChI=1S/C20H18F4N2O2/c1-10-7-13(5-6-17(10)28-11(2)21)20(19(27)26(4)12(3)25-20)14-8-15(22)18(24)16(23)9-14/h5-9,11H,1-4H3 |
| InChIKey | NRCSIYWRGBBVNJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|