About triethylphosphane;zirconium(2+);dichloride
triethylphosphane;zirconium(2+);dichloride (PubChem CID 159860851) has the molecular formula C6H15Cl2PZr
and a molecular weight of 280.29 g/mol. Its IUPAC name is triethylphosphane;zirconium(2+);dichloride.
Molecular Properties
| Compound Name | triethylphosphane;zirconium(2+);dichloride |
| PubChem CID | 159860851 |
| Molecular Formula | C6H15Cl2PZr |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 277.93 |
| IUPAC Name | triethylphosphane;zirconium(2+);dichloride |
| SMILES | CCP(CC)CC.[Cl-].[Cl-].[Zr+2] |
| InChI | InChI=1S/C6H15P.2ClH.Zr/c1-4-7(5-2)6-3;;;/h4-6H2,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | NRCWBINXBKCQPS-UHFFFAOYSA-L |
| XLogP | -3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triethylphosphane;zirconium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylphosphane;zirconium(2+);dichloride?
The IUPAC name of triethylphosphane;zirconium(2+);dichloride (CID 159860851) is triethylphosphane;zirconium(2+);dichloride.
What is the SMILES notation for triethylphosphane;zirconium(2+);dichloride?
The canonical SMILES for triethylphosphane;zirconium(2+);dichloride is CCP(CC)CC.[Cl-].[Cl-].[Zr+2].
What is the InChIKey of triethylphosphane;zirconium(2+);dichloride?
The InChIKey is NRCWBINXBKCQPS-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H15P.2ClH.Zr/c1-4-7(5-2)6-3;;;/h4-6H2,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of triethylphosphane;zirconium(2+);dichloride?
triethylphosphane;zirconium(2+);dichloride has a molecular weight of 280.29 g/mol, XLogP of -3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylphosphane;zirconium(2+);dichloride is sourced from PubChem (CID 159860851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).