C14H11BrF2NOY- — CID 159860968
2-(4-bromo-2-methylphenyl)-1-(2,2-difluoroethyl)-3H-pyridin-3-id-6-one;yttrium (PubChem CID 159860968) has the molecular formula C14H11BrF2NOY- and a molecular weight of 416.05 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)-1-(2,2-difluoroethyl)-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 2-(4-bromo-2-methylphenyl)-1-(2,2-difluoroethyl)-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 159860968 |
| Molecular Formula | C14H11BrF2NOY- |
| Molecular Weight | 416.05 g/mol |
| Exact Mass | 414.91 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)-1-(2,2-difluoroethyl)-3H-pyridin-3-id-6-one;yttrium |
| SMILES | Cc1cc(Br)ccc1-c1[c-]ccc(=O)n1CC(F)F.[Y] |
| InChI | InChI=1S/C14H11BrF2NO.Y/c1-9-7-10(15)5-6-11(9)12-3-2-4-14(19)18(12)8-13(16)17;/h2,4-7,13H,8H2,1H3;/q-1; |
| InChIKey | GRSOJDGKTIMJMW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.05 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|