C67H92N2O2 — CID 159861430
4-[2-(4-heptanoylphenyl)phenyl]-1-heptylcyclohexane-1-carbonitrile;1-heptyl-4-[2-(4-octanoylphenyl)phenyl]cyclohexane-1-carbonitrile (PubChem CID 159861430) has the molecular formula C67H92N2O2 and a molecular weight of 957.48 g/mol. Its IUPAC name is 4-[2-(4-heptanoylphenyl)phenyl]-1-heptylcyclohexane-1-carbonitrile;1-heptyl-4-[2-(4-octanoylphenyl)phenyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[2-(4-heptanoylphenyl)phenyl]-1-heptylcyclohexane-1-carbonitrile;1-heptyl-4-[2-(4-octanoylphenyl)phenyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 159861430 |
| Molecular Formula | C67H92N2O2 |
| Molecular Weight | 957.48 g/mol |
| Exact Mass | 956.72 |
| IUPAC Name | 4-[2-(4-heptanoylphenyl)phenyl]-1-heptylcyclohexane-1-carbonitrile;1-heptyl-4-[2-(4-octanoylphenyl)phenyl]cyclohexane-1-carbonitrile |
| SMILES | CCCCCCCC(=O)c1ccc(-c2ccccc2C2CCC(C#N)(CCCCCCC)CC2)cc1.CCCCCCCC1(C#N)CCC(c2ccccc2-c2ccc(C(=O)CCCCCC)cc2)CC1 |
| InChI | InChI=1S/C34H47NO.C33H45NO/c1-3-5-7-9-11-17-33(36)30-20-18-28(19-21-30)31-15-12-13-16-32(31)29-22-25-34(27-35,26-23-29)24-14-10-8-6-4-2;1-3-5-7-9-13-23-33(26-34)24-21-28(22-25-33)31-15-12-11-14-30(31)27-17-19-29(20-18-27)32(35)16-10-8-6-4-2/h12-13,15-16,18-21,29H,3-11,14,17,22-26H2,1-2H3;11-12,14-15,17-20,28H,3-10,13,16,21-25H2,1-2H3 |
| InChIKey | NREQYINCYQKBIO-UHFFFAOYSA-N |
| XLogP | 20.46 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.48 |
| LogP ≤ 5 | 20.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|