About 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile
4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (PubChem CID 159861879) has the molecular formula C26H20N6O
and a molecular weight of 432.49 g/mol. Its IUPAC name is 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| PubChem CID | 159861879 |
| Molecular Formula | C26H20N6O |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)ncc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C26H20N6O/c1-16-11-19(14-28)12-17(2)24(16)33-25-23(20-5-7-21(29)8-6-20)15-30-26(32-25)31-22-9-3-18(13-27)4-10-22/h3-12,15H,29H2,1-2H3,(H,30,31,32) |
| InChIKey | NRGCMLWCGWFVOW-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The IUPAC name of 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (CID 159861879) is 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)ncc1-c1ccc(N)cc1.
What is the InChIKey of 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The InChIKey is NRGCMLWCGWFVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N6O/c1-16-11-19(14-28)12-17(2)24(16)33-25-23(20-5-7-21(29)8-6-20)15-30-26(32-25)31-22-9-3-18(13-27)4-10-22/h3-12,15H,29H2,1-2H3,(H,30,31,32).
What are the key properties of 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile has a molecular weight of 432.49 g/mol, XLogP of 5.62, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-aminophenyl)-2-(4-cyanoanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile is sourced from PubChem (CID 159861879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).