About 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine
1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine (PubChem CID 159862545) has the molecular formula C11H17F6NO4S2
and a molecular weight of 405.38 g/mol. Its IUPAC name is 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine.
Molecular Properties
| Compound Name | 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine |
| PubChem CID | 159862545 |
| Molecular Formula | C11H17F6NO4S2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine |
| SMILES | CCCCN1CCC(S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F6NO4S2/c1-2-3-6-18-7-4-9(5-8-18,23(19,20)10(12,13)14)24(21,22)11(15,16)17/h2-8H2,1H3 |
| InChIKey | KZOSUBAZYNSLIO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine?
The IUPAC name of 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine (CID 159862545) is 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine.
What is the SMILES notation for 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine?
The canonical SMILES for 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine is CCCCN1CCC(S(=O)(=O)C(F)(F)F)(S(=O)(=O)C(F)(F)F)CC1.
What is the InChIKey of 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine?
The InChIKey is KZOSUBAZYNSLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F6NO4S2/c1-2-3-6-18-7-4-9(5-8-18,23(19,20)10(12,13)14)24(21,22)11(15,16)17/h2-8H2,1H3.
What are the key properties of 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine?
1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine has a molecular weight of 405.38 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4,4-bis(trifluoromethylsulfonyl)piperidine is sourced from PubChem (CID 159862545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).