About 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride
4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride (PubChem CID 159862843) has the molecular formula C8H10Cl2N3OZn-
and a molecular weight of 300.48 g/mol. Its IUPAC name is 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride.
Molecular Properties
| Compound Name | 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride |
| PubChem CID | 159862843 |
| Molecular Formula | C8H10Cl2N3OZn- |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride |
| SMILES | N#[N+]c1ccc(NCCO)cc1.[Cl-].[Cl-].[Zn] |
| InChI | InChI=1S/C8H10N3O.2ClH.Zn/c9-11-8-3-1-7(2-4-8)10-5-6-12;;;/h1-4,10,12H,5-6H2;2*1H;/q+1;;;/p-2 |
| InChIKey | PFOKCPMJXJDWFG-UHFFFAOYSA-L |
| XLogP | -4.42 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride?
The IUPAC name of 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride (CID 159862843) is 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride.
What is the SMILES notation for 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride?
The canonical SMILES for 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride is N#[N+]c1ccc(NCCO)cc1.[Cl-].[Cl-].[Zn].
What is the InChIKey of 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride?
The InChIKey is PFOKCPMJXJDWFG-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H10N3O.2ClH.Zn/c9-11-8-3-1-7(2-4-8)10-5-6-12;;;/h1-4,10,12H,5-6H2;2*1H;/q+1;;;/p-2.
What are the key properties of 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride?
4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride has a molecular weight of 300.48 g/mol, XLogP of -4.42, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethylamino)benzenediazonium;zinc;dichloride is sourced from PubChem (CID 159862843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).