About (Z)-2-isocyanobut-2-ene;isocyanoethane
(Z)-2-isocyanobut-2-ene;isocyanoethane (PubChem CID 159863106) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (Z)-2-isocyanobut-2-ene;isocyanoethane.
Molecular Properties
| Compound Name | (Z)-2-isocyanobut-2-ene;isocyanoethane |
| PubChem CID | 159863106 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (Z)-2-isocyanobut-2-ene;isocyanoethane |
| SMILES | [C-]#[N+]/C(C)=C\C.[C-]#[N+]CC |
| InChI | InChI=1S/C5H7N.C3H5N/c1-4-5(2)6-3;1-3-4-2/h4H,1-2H3;3H2,1H3/b5-4-; |
| InChIKey | NRJYUJKKPARWKL-MKWAYWHRSA-N |
| XLogP | 2.75 |
| TPSA | 8.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-isocyanobut-2-ene;isocyanoethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-isocyanobut-2-ene;isocyanoethane?
The IUPAC name of (Z)-2-isocyanobut-2-ene;isocyanoethane (CID 159863106) is (Z)-2-isocyanobut-2-ene;isocyanoethane.
What is the SMILES notation for (Z)-2-isocyanobut-2-ene;isocyanoethane?
The canonical SMILES for (Z)-2-isocyanobut-2-ene;isocyanoethane is [C-]#[N+]/C(C)=C\C.[C-]#[N+]CC.
What is the InChIKey of (Z)-2-isocyanobut-2-ene;isocyanoethane?
The InChIKey is NRJYUJKKPARWKL-MKWAYWHRSA-N. The full InChI is InChI=1S/C5H7N.C3H5N/c1-4-5(2)6-3;1-3-4-2/h4H,1-2H3;3H2,1H3/b5-4-;.
What are the key properties of (Z)-2-isocyanobut-2-ene;isocyanoethane?
(Z)-2-isocyanobut-2-ene;isocyanoethane has a molecular weight of 136.20 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-isocyanobut-2-ene;isocyanoethane is sourced from PubChem (CID 159863106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).