About 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde
3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde (PubChem CID 15986316) has the molecular formula C11H8ClNO2S
and a molecular weight of 253.71 g/mol. Its IUPAC name is 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde.
Molecular Properties
| Compound Name | 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde |
| PubChem CID | 15986316 |
| Molecular Formula | C11H8ClNO2S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde |
| SMILES | O=Cc1cccc(Cn2sc(Cl)cc2=O)c1 |
| InChI | InChI=1S/C11H8ClNO2S/c12-10-5-11(15)13(16-10)6-8-2-1-3-9(4-8)7-14/h1-5,7H,6H2 |
| InChIKey | CWMFKTYDZNLHGL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde?
The IUPAC name of 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde (CID 15986316) is 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde.
What is the SMILES notation for 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde?
The canonical SMILES for 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde is O=Cc1cccc(Cn2sc(Cl)cc2=O)c1.
What is the InChIKey of 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde?
The InChIKey is CWMFKTYDZNLHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO2S/c12-10-5-11(15)13(16-10)6-8-2-1-3-9(4-8)7-14/h1-5,7H,6H2.
What are the key properties of 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde?
3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde has a molecular weight of 253.71 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-3-oxo-1,2-thiazol-2-yl)methyl]benzaldehyde is sourced from PubChem (CID 15986316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).