C17H13F2N3O2 — CID 15986332
3-[2-[6-(2,3-difluorophenyl)-3-pyridinyl]cyclopropyl]imidazolidine-2,4-dione (PubChem CID 15986332) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-[2-[6-(2,3-difluorophenyl)-3-pyridinyl]cyclopropyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[6-(2,3-difluorophenyl)-3-pyridinyl]cyclopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 15986332 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-[2-[6-(2,3-difluorophenyl)-3-pyridinyl]cyclopropyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1C1CC1c1ccc(-c2cccc(F)c2F)nc1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-12-3-1-2-10(16(12)19)13-5-4-9(7-20-13)11-6-14(11)22-15(23)8-21-17(22)24/h1-5,7,11,14H,6,8H2,(H,21,24) |
| InChIKey | OAMGDXCLHGZSAW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|