C14H24N2O4 — CID 159863647
4-ethenyl-1,3-oxazolidin-2-one;N-(1-hydroxybut-3-en-2-yl)-2,2-dimethylpropanamide (PubChem CID 159863647) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-ethenyl-1,3-oxazolidin-2-one;N-(1-hydroxybut-3-en-2-yl)-2,2-dimethylpropanamide.
| Compound Name | 4-ethenyl-1,3-oxazolidin-2-one;N-(1-hydroxybut-3-en-2-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 159863647 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-ethenyl-1,3-oxazolidin-2-one;N-(1-hydroxybut-3-en-2-yl)-2,2-dimethylpropanamide |
| SMILES | C=CC(CO)NC(=O)C(C)(C)C.C=CC1COC(=O)N1 |
| InChI | InChI=1S/C9H17NO2.C5H7NO2/c1-5-7(6-11)10-8(12)9(2,3)4;1-2-4-3-8-5(7)6-4/h5,7,11H,1,6H2,2-4H3,(H,10,12);2,4H,1,3H2,(H,6,7) |
| InChIKey | NRLOJTKZBGZWTF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|