C17H21N9O6 — CID 159864050
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;3,7-dimethylpurine-2,6-dione (PubChem CID 159864050) has the molecular formula C17H21N9O6 and a molecular weight of 447.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;3,7-dimethylpurine-2,6-dione.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 159864050 |
| Molecular Formula | C17H21N9O6 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2C.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H13N5O4.C7H8N4O2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);3H,1-2H3,(H,9,12,13)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | NRMXHDKAQBYMFA-MCDZGGTQSA-N |
| XLogP | -3.02 |
| TPSA | 212.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |