About 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane
1-methylcyclohex-2-en-1-ol;methylsulfanylmethane (PubChem CID 159864702) has the molecular formula C9H18OS
and a molecular weight of 174.31 g/mol. Its IUPAC name is 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane.
Molecular Properties
| Compound Name | 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane |
| PubChem CID | 159864702 |
| Molecular Formula | C9H18OS |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane |
| SMILES | CC1(O)C=CCCC1.CSC |
| InChI | InChI=1S/C7H12O.C2H6S/c1-7(8)5-3-2-4-6-7;1-3-2/h3,5,8H,2,4,6H2,1H3;1-2H3 |
| InChIKey | NROWXCMEONQLHF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane?
The IUPAC name of 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane (CID 159864702) is 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane.
What is the SMILES notation for 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane?
The canonical SMILES for 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane is CC1(O)C=CCCC1.CSC.
What is the InChIKey of 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane?
The InChIKey is NROWXCMEONQLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C2H6S/c1-7(8)5-3-2-4-6-7;1-3-2/h3,5,8H,2,4,6H2,1H3;1-2H3.
What are the key properties of 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane?
1-methylcyclohex-2-en-1-ol;methylsulfanylmethane has a molecular weight of 174.31 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclohex-2-en-1-ol;methylsulfanylmethane is sourced from PubChem (CID 159864702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).