About 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride
1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride (PubChem CID 159866573) has the molecular formula C5H14ClNO2
and a molecular weight of 155.62 g/mol. Its IUPAC name is 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride.
Molecular Properties
| Compound Name | 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride |
| PubChem CID | 159866573 |
| Molecular Formula | C5H14ClNO2 |
| Molecular Weight | 155.62 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride |
| SMILES | C=C(O)[N+](C)(C)CO.[Cl-].[H][H] |
| InChI | InChI=1S/C5H11NO2.ClH.H2/c1-5(8)6(2,3)4-7;;/h7H,1,4H2,2-3H3;2*1H |
| InChIKey | VDKYDANEWSWHDL-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.62 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride?
The IUPAC name of 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride (CID 159866573) is 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride.
What is the SMILES notation for 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride?
The canonical SMILES for 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride is C=C(O)[N+](C)(C)CO.[Cl-].[H][H].
What is the InChIKey of 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride?
The InChIKey is VDKYDANEWSWHDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.ClH.H2/c1-5(8)6(2,3)4-7;;/h7H,1,4H2,2-3H3;2*1H.
What are the key properties of 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride?
1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride has a molecular weight of 155.62 g/mol, XLogP of -2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethenyl-(hydroxymethyl)-dimethylazanium;molecular hydrogen;chloride is sourced from PubChem (CID 159866573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).