C10H14BNO4 — CID 159866882
5-methyl-1-[(1E,3Z)-penta-1,3-dienyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione (PubChem CID 159866882) has the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. Its IUPAC name is 5-methyl-1-[(1E,3Z)-penta-1,3-dienyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione.
| Compound Name | 5-methyl-1-[(1E,3Z)-penta-1,3-dienyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
|---|---|
| PubChem CID | 159866882 |
| Molecular Formula | C10H14BNO4 |
| Molecular Weight | 223.04 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-methyl-1-[(1E,3Z)-penta-1,3-dienyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
| SMILES | C/C=C\C=C\[B-]12OC(=O)C[N+]1(C)CC(=O)O2 |
| InChI | InChI=1S/C10H14BNO4/c1-3-4-5-6-11-12(2,7-9(13)15-11)8-10(14)16-11/h3-6H,7-8H2,1-2H3/b4-3-,6-5+ |
| InChIKey | NRVNRXSEDLFGDX-DNVGVPOPSA-N |
| XLogP | 0.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.04 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|