C38H37F4N5O7 — CID 159869270
N-[1-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxymethyl]cyclohexyl]-5-fluorobenzimidazol-2-yl]-3-(trifluoromethyl)benzamide;methane (PubChem CID 159869270) has the molecular formula C38H37F4N5O7 and a molecular weight of 751.73 g/mol. Its IUPAC name is N-[1-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxymethyl]cyclohexyl]-5-fluorobenzimidazol-2-yl]-3-(trifluoromethyl)benzamide;methane.
| Compound Name | N-[1-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxymethyl]cyclohexyl]-5-fluorobenzimidazol-2-yl]-3-(trifluoromethyl)benzamide;methane |
|---|---|
| PubChem CID | 159869270 |
| Molecular Formula | C38H37F4N5O7 |
| Molecular Weight | 751.73 g/mol |
| Exact Mass | 751.26 |
| IUPAC Name | N-[1-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxymethyl]cyclohexyl]-5-fluorobenzimidazol-2-yl]-3-(trifluoromethyl)benzamide;methane |
| SMILES | C.O=C1CCC(N2C(=O)c3ccc(OCCOCC4CCC(n5c(NC(=O)c6cccc(C(F)(F)F)c6)nc6cc(F)ccc65)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C37H33F4N5O7.CH4/c38-23-6-11-29-28(17-23)42-36(44-32(48)21-2-1-3-22(16-21)37(39,40)41)45(29)24-7-4-20(5-8-24)19-52-14-15-53-25-9-10-26-27(18-25)35(51)46(34(26)50)30-12-13-31(47)43-33(30)49;/h1-3,6,9-11,16-18,20,24,30H,4-5,7-8,12-15,19H2,(H,42,44,48)(H,43,47,49);1H4 |
| InChIKey | NSCYUNUGSOOCAA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|