C19H18F6N5O6PS — CID 15987242
6-(1,3-benzodioxol-5-ylsulfanyl)-9-[2-[bis(2,2,2-trifluoroethoxy)phosphorylmethoxy]ethyl]purin-2-amine (PubChem CID 15987242) has the molecular formula C19H18F6N5O6PS and a molecular weight of 589.41 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylsulfanyl)-9-[2-[bis(2,2,2-trifluoroethoxy)phosphorylmethoxy]ethyl]purin-2-amine.
| Compound Name | 6-(1,3-benzodioxol-5-ylsulfanyl)-9-[2-[bis(2,2,2-trifluoroethoxy)phosphorylmethoxy]ethyl]purin-2-amine |
|---|---|
| PubChem CID | 15987242 |
| Molecular Formula | C19H18F6N5O6PS |
| Molecular Weight | 589.41 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylsulfanyl)-9-[2-[bis(2,2,2-trifluoroethoxy)phosphorylmethoxy]ethyl]purin-2-amine |
| SMILES | Nc1nc(Sc2ccc3c(c2)OCO3)c2ncn(CCOCP(=O)(OCC(F)(F)F)OCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C19H18F6N5O6PS/c20-18(21,22)6-35-37(31,36-7-19(23,24)25)10-32-4-3-30-8-27-14-15(30)28-17(26)29-16(14)38-11-1-2-12-13(5-11)34-9-33-12/h1-2,5,8H,3-4,6-7,9-10H2,(H2,26,28,29) |
| InChIKey | RPUYZPWFSCSGBQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|