About sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate
sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate (PubChem CID 159873174) has the molecular formula C12H18N3NaO2
and a molecular weight of 259.28 g/mol. Its IUPAC name is sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate.
Molecular Properties
| Compound Name | sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate |
| PubChem CID | 159873174 |
| Molecular Formula | C12H18N3NaO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate |
| SMILES | CC[O-].[H]/N=C(\OCC)c1cncc(C2CC2)n1.[Na+] |
| InChI | InChI=1S/C10H13N3O.C2H5O.Na/c1-2-14-10(11)9-6-12-5-8(13-9)7-3-4-7;1-2-3;/h5-7,11H,2-4H2,1H3;2H2,1H3;/q;-1;+1/b11-10-;; |
| InChIKey | NSOJOXBJHOALLI-PQBRBDCOSA-N |
| XLogP | -1.91 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate?
The IUPAC name of sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate (CID 159873174) is sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate.
What is the SMILES notation for sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate?
The canonical SMILES for sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate is CC[O-].[H]/N=C(\OCC)c1cncc(C2CC2)n1.[Na+].
What is the InChIKey of sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate?
The InChIKey is NSOJOXBJHOALLI-PQBRBDCOSA-N. The full InChI is InChI=1S/C10H13N3O.C2H5O.Na/c1-2-14-10(11)9-6-12-5-8(13-9)7-3-4-7;1-2-3;/h5-7,11H,2-4H2,1H3;2H2,1H3;/q;-1;+1/b11-10-;;.
What are the key properties of sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate?
sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate has a molecular weight of 259.28 g/mol, XLogP of -1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethanolate;ethyl 6-cyclopropylpyrazine-2-carboximidate is sourced from PubChem (CID 159873174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).