C57H72N12O6 — CID 159874524
ethyl 4-[[3-(2-cyanoethyl)cyclohexyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 159874524) has the molecular formula C57H72N12O6 and a molecular weight of 1021.28 g/mol. Its IUPAC name is ethyl 4-[[3-(2-cyanoethyl)cyclohexyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | ethyl 4-[[3-(2-cyanoethyl)cyclohexyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 159874524 |
| Molecular Formula | C57H72N12O6 |
| Molecular Weight | 1021.28 g/mol |
| Exact Mass | 1020.57 |
| IUPAC Name | ethyl 4-[[3-(2-cyanoethyl)cyclohexyl]amino]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2[nH]ccc2c1NC1CCCC(CCC#N)C1.CCOC(=O)c1cnc2[nH]ccc2c1NC1CCCC(CCC#N)C1.CCOC(=O)c1cnc2[nH]ccc2c1NC1CCCC(CCC#N)C1 |
| InChI | InChI=1S/3C19H24N4O2/c3*1-2-25-19(24)16-12-22-18-15(8-10-21-18)17(16)23-14-7-3-5-13(11-14)6-4-9-20/h3*8,10,12-14H,2-7,11H2,1H3,(H2,21,22,23) |
| InChIKey | NSSRVAMDUQZEBI-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 272.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 75 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.28 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|