About 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine
5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 15987565) has the molecular formula C18H18N4O3S
and a molecular weight of 370.43 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine |
| PubChem CID | 15987565 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2nc(C)nc(N)c2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N4O3S/c1-12-20-17(19)16(26(23,24)15-6-4-3-5-7-15)18(21-12)22-13-8-10-14(25-2)11-9-13/h3-11H,1-2H3,(H3,19,20,21,22) |
| InChIKey | OVZCVNHDCQYQDZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine?
The IUPAC name of 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine (CID 15987565) is 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine.
What is the SMILES notation for 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine?
The canonical SMILES for 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine is COc1ccc(Nc2nc(C)nc(N)c2S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine?
The InChIKey is OVZCVNHDCQYQDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3S/c1-12-20-17(19)16(26(23,24)15-6-4-3-5-7-15)18(21-12)22-13-8-10-14(25-2)11-9-13/h3-11H,1-2H3,(H3,19,20,21,22).
What are the key properties of 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine?
5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine has a molecular weight of 370.43 g/mol, XLogP of 2.95, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-4-N-(4-methoxyphenyl)-2-methylpyrimidine-4,6-diamine is sourced from PubChem (CID 15987565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).