C19H14N4O3S — CID 159875924
2-(3-isocyano-4-methoxyphenyl)-5-[(4-methoxy-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazole (PubChem CID 159875924) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is 2-(3-isocyano-4-methoxyphenyl)-5-[(4-methoxy-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3-isocyano-4-methoxyphenyl)-5-[(4-methoxy-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 159875924 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-(3-isocyano-4-methoxyphenyl)-5-[(4-methoxy-1,3-benzothiazol-2-yl)methyl]-1,3,4-oxadiazole |
| SMILES | [C-]#[N+]c1cc(-c2nnc(Cc3nc4c(OC)cccc4s3)o2)ccc1OC |
| InChI | InChI=1S/C19H14N4O3S/c1-20-12-9-11(7-8-13(12)24-2)19-23-22-16(26-19)10-17-21-18-14(25-3)5-4-6-15(18)27-17/h4-9H,10H2,2-3H3 |
| InChIKey | BUFMGHNJYWRYOX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 74.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|