About ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate
ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate (PubChem CID 15987613) has the molecular formula C11H14N4O3
and a molecular weight of 250.26 g/mol. Its IUPAC name is ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate |
| PubChem CID | 15987613 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate |
| SMILES | CCOC(=O)C(C)Nc1ncnc2onc(C)c12 |
| InChI | InChI=1S/C11H14N4O3/c1-4-17-11(16)7(3)14-9-8-6(2)15-18-10(8)13-5-12-9/h5,7H,4H2,1-3H3,(H,12,13,14) |
| InChIKey | CZGABJFWXGVPNW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate?
The IUPAC name of ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate (CID 15987613) is ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate.
What is the SMILES notation for ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate?
The canonical SMILES for ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate is CCOC(=O)C(C)Nc1ncnc2onc(C)c12.
What is the InChIKey of ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate?
The InChIKey is CZGABJFWXGVPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O3/c1-4-17-11(16)7(3)14-9-8-6(2)15-18-10(8)13-5-12-9/h5,7H,4H2,1-3H3,(H,12,13,14).
What are the key properties of ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate?
ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate has a molecular weight of 250.26 g/mol, XLogP of 1.29, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanoate is sourced from PubChem (CID 15987613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).