C24H25F3N4O — CID 15987651
N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-(trifluoromethyl)benzamide (PubChem CID 15987651) has the molecular formula C24H25F3N4O and a molecular weight of 442.49 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 15987651 |
| Molecular Formula | C24H25F3N4O |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-(trifluoromethyl)benzamide |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=O)c4cccc(C(F)(F)F)c4)ccc3n2)CC1 |
| InChI | InChI=1S/C24H25F3N4O/c1-3-30-9-11-31(12-10-30)22-13-16(2)20-15-19(7-8-21(20)29-22)28-23(32)17-5-4-6-18(14-17)24(25,26)27/h4-8,13-15H,3,9-12H2,1-2H3,(H,28,32) |
| InChIKey | BNXZTKURBIUJKE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |