C28H26ClFO4S — CID 159877137
1-[4-[3-(4-chloro-3-fluorophenoxy)-3-methylbut-1-ynyl]phenyl]-3-(4-ethylsulfonylphenyl)propan-2-one (PubChem CID 159877137) has the molecular formula C28H26ClFO4S and a molecular weight of 513.03 g/mol. Its IUPAC name is 1-[4-[3-(4-chloro-3-fluorophenoxy)-3-methylbut-1-ynyl]phenyl]-3-(4-ethylsulfonylphenyl)propan-2-one.
| Compound Name | 1-[4-[3-(4-chloro-3-fluorophenoxy)-3-methylbut-1-ynyl]phenyl]-3-(4-ethylsulfonylphenyl)propan-2-one |
|---|---|
| PubChem CID | 159877137 |
| Molecular Formula | C28H26ClFO4S |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 1-[4-[3-(4-chloro-3-fluorophenoxy)-3-methylbut-1-ynyl]phenyl]-3-(4-ethylsulfonylphenyl)propan-2-one |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Cc2ccc(C#CC(C)(C)Oc3ccc(Cl)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C28H26ClFO4S/c1-4-35(32,33)25-12-9-22(10-13-25)18-23(31)17-21-7-5-20(6-8-21)15-16-28(2,3)34-24-11-14-26(29)27(30)19-24/h5-14,19H,4,17-18H2,1-3H3 |
| InChIKey | NTAYCHODBFKKDS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|