About 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane
6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane (PubChem CID 159877361) has the molecular formula C15H26O3S
and a molecular weight of 286.44 g/mol. Its IUPAC name is 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane.
Molecular Properties
| Compound Name | 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane |
| PubChem CID | 159877361 |
| Molecular Formula | C15H26O3S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane |
| SMILES | C.C.COC(CCS(=O)c1ccccc1)CC(C)=O |
| InChI | InChI=1S/C13H18O3S.2CH4/c1-11(14)10-12(16-2)8-9-17(15)13-6-4-3-5-7-13;;/h3-7,12H,8-10H2,1-2H3;2*1H4 |
| InChIKey | NTBSFDNWFOAMRC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane?
The IUPAC name of 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane (CID 159877361) is 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane.
What is the SMILES notation for 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane?
The canonical SMILES for 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane is C.C.COC(CCS(=O)c1ccccc1)CC(C)=O.
What is the InChIKey of 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane?
The InChIKey is NTBSFDNWFOAMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3S.2CH4/c1-11(14)10-12(16-2)8-9-17(15)13-6-4-3-5-7-13;;/h3-7,12H,8-10H2,1-2H3;2*1H4.
What are the key properties of 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane?
6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane has a molecular weight of 286.44 g/mol, XLogP of 3.45, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzenesulfinyl)-4-methoxyhexan-2-one;methane is sourced from PubChem (CID 159877361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).