C21H19ClFNO5 — CID 159877431
6-[3-[(2-chloro-4-methoxyphenyl)methoxy]azetidine-1-carbonyl]-7-fluoro-4H-chromen-3-one (PubChem CID 159877431) has the molecular formula C21H19ClFNO5 and a molecular weight of 419.84 g/mol. Its IUPAC name is 6-[3-[(2-chloro-4-methoxyphenyl)methoxy]azetidine-1-carbonyl]-7-fluoro-4H-chromen-3-one.
| Compound Name | 6-[3-[(2-chloro-4-methoxyphenyl)methoxy]azetidine-1-carbonyl]-7-fluoro-4H-chromen-3-one |
|---|---|
| PubChem CID | 159877431 |
| Molecular Formula | C21H19ClFNO5 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 6-[3-[(2-chloro-4-methoxyphenyl)methoxy]azetidine-1-carbonyl]-7-fluoro-4H-chromen-3-one |
| SMILES | COc1ccc(COC2CN(C(=O)c3cc4c(cc3F)OCC(=O)C4)C2)c(Cl)c1 |
| InChI | InChI=1S/C21H19ClFNO5/c1-27-15-3-2-12(18(22)6-15)10-28-16-8-24(9-16)21(26)17-5-13-4-14(25)11-29-20(13)7-19(17)23/h2-3,5-7,16H,4,8-11H2,1H3 |
| InChIKey | NTBZILNYRMYSOW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |