About methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate
methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate (PubChem CID 159878196) has the molecular formula C14H23NO8S
and a molecular weight of 365.40 g/mol. Its IUPAC name is methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate |
| PubChem CID | 159878196 |
| Molecular Formula | C14H23NO8S |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1=CC=CN(C2CC(CO)C(O)C2O)C1.CS(=O)(=O)O |
| InChI | InChI=1S/C13H19NO5.CH4O3S/c1-19-13(18)8-3-2-4-14(6-8)10-5-9(7-15)11(16)12(10)17;1-5(2,3)4/h2-4,9-12,15-17H,5-7H2,1H3;1H3,(H,2,3,4) |
| InChIKey | YSCKRTUDSLFHAZ-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate?
The IUPAC name of methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate (CID 159878196) is methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate.
What is the SMILES notation for methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate?
The canonical SMILES for methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate is COC(=O)C1=CC=CN(C2CC(CO)C(O)C2O)C1.CS(=O)(=O)O.
What is the InChIKey of methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate?
The InChIKey is YSCKRTUDSLFHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5.CH4O3S/c1-19-13(18)8-3-2-4-14(6-8)10-5-9(7-15)11(16)12(10)17;1-5(2,3)4/h2-4,9-12,15-17H,5-7H2,1H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate?
methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate has a molecular weight of 365.40 g/mol, XLogP of -1.48, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;methyl 1-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-2H-pyridine-3-carboxylate is sourced from PubChem (CID 159878196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).