C18H30N7O4S+ — CID 159878465
2-carboxyethyl-dimethyl-[5-[2-[(3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carbonyl)amino]ethylsulfanyl]pentyl]azanium (PubChem CID 159878465) has the molecular formula C18H30N7O4S+ and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-carboxyethyl-dimethyl-[5-[2-[(3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carbonyl)amino]ethylsulfanyl]pentyl]azanium.
| Compound Name | 2-carboxyethyl-dimethyl-[5-[2-[(3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carbonyl)amino]ethylsulfanyl]pentyl]azanium |
|---|---|
| PubChem CID | 159878465 |
| Molecular Formula | C18H30N7O4S+ |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-carboxyethyl-dimethyl-[5-[2-[(3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carbonyl)amino]ethylsulfanyl]pentyl]azanium |
| SMILES | Cn1nnc2c(C(=O)NCCSCCCCC[N+](C)(C)CCC(=O)O)ncn2c1=O |
| InChI | InChI=1S/C18H29N7O4S/c1-23-18(29)24-13-20-15(16(24)21-22-23)17(28)19-8-12-30-11-6-4-5-9-25(2,3)10-7-14(26)27/h13H,4-12H2,1-3H3,(H-,19,26,27,28)/p+1 |
| InChIKey | NALVCUAAZJHHRP-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 131.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|