C28H36N4O4 — CID 15987878
3,4,5-triethoxy-N-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]benzamide (PubChem CID 15987878) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 15987878 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 3,4,5-triethoxy-N-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3nc(N4CCN(C)CC4)cc(C)c3c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C28H36N4O4/c1-6-34-24-16-20(17-25(35-7-2)27(24)36-8-3)28(33)29-21-9-10-23-22(18-21)19(4)15-26(30-23)32-13-11-31(5)12-14-32/h9-10,15-18H,6-8,11-14H2,1-5H3,(H,29,33) |
| InChIKey | NMXNEDHWJAESCI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |