C21H31N3O3 — CID 15987928
N-[1-(4-acetamidoanilino)-3-methyl-1-oxobutan-2-yl]-4-methylcyclohexane-1-carboxamide (PubChem CID 15987928) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is N-[1-(4-acetamidoanilino)-3-methyl-1-oxobutan-2-yl]-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-[1-(4-acetamidoanilino)-3-methyl-1-oxobutan-2-yl]-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 15987928 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | N-[1-(4-acetamidoanilino)-3-methyl-1-oxobutan-2-yl]-4-methylcyclohexane-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(NC(=O)C2CCC(C)CC2)C(C)C)cc1 |
| InChI | InChI=1S/C21H31N3O3/c1-13(2)19(24-20(26)16-7-5-14(3)6-8-16)21(27)23-18-11-9-17(10-12-18)22-15(4)25/h9-14,16,19H,5-8H2,1-4H3,(H,22,25)(H,23,27)(H,24,26) |
| InChIKey | BELKNGJWBKIDDS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |