C21H34N3O5P — CID 159880591
1-[(2R,6S)-6-(deuteriomethyl)-6-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]oxan-2-yl]pyridine-2,4-dione (PubChem CID 159880591) has the molecular formula C21H34N3O5P and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[(2R,6S)-6-(deuteriomethyl)-6-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]oxan-2-yl]pyridine-2,4-dione.
| Compound Name | 1-[(2R,6S)-6-(deuteriomethyl)-6-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]oxan-2-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 159880591 |
| Molecular Formula | C21H34N3O5P |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-[(2R,6S)-6-(deuteriomethyl)-6-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]oxan-2-yl]pyridine-2,4-dione |
| SMILES | [2H]C[C@@]1(COP(OCC[N+]#[C-])N(C(C)C)C(C)C)CCC[C@H](N2C=CC(=O)CC2=O)O1 |
| InChI | InChI=1S/C21H34N3O5P/c1-16(2)24(17(3)4)30(27-13-11-22-6)28-15-21(5)10-7-8-20(29-21)23-12-9-18(25)14-19(23)26/h9,12,16-17,20H,7-8,10-11,13-15H2,1-5H3/t20-,21+,30?/m1/s1/i5D |
| InChIKey | DJLPCOFBDAQBJJ-QBHVPRBGSA-N |
| XLogP | 3.88 |
| TPSA | 72.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|