C16H8ClFN4O3S — CID 15988065
5-(3-chloro-4-fluoroanilino)-12,14-dioxa-4-thia-2,6,7-triazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,5,9,11(15)-pentaen-8-one (PubChem CID 15988065) has the molecular formula C16H8ClFN4O3S and a molecular weight of 390.78 g/mol. Its IUPAC name is 5-(3-chloro-4-fluoroanilino)-12,14-dioxa-4-thia-2,6,7-triazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,5,9,11(15)-pentaen-8-one.
| Compound Name | 5-(3-chloro-4-fluoroanilino)-12,14-dioxa-4-thia-2,6,7-triazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,5,9,11(15)-pentaen-8-one |
|---|---|
| PubChem CID | 15988065 |
| Molecular Formula | C16H8ClFN4O3S |
| Molecular Weight | 390.78 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 5-(3-chloro-4-fluoroanilino)-12,14-dioxa-4-thia-2,6,7-triazatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,5,9,11(15)-pentaen-8-one |
| SMILES | O=c1c2cc3c(cc2nc2sc(Nc4ccc(F)c(Cl)c4)nn12)OCO3 |
| InChI | InChI=1S/C16H8ClFN4O3S/c17-9-3-7(1-2-10(9)18)19-15-21-22-14(23)8-4-12-13(25-6-24-12)5-11(8)20-16(22)26-15/h1-5H,6H2,(H,19,21) |
| InChIKey | VVWFNPORPHLADK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |