About N-ethylacetamide;1H-pyrazole
N-ethylacetamide;1H-pyrazole (PubChem CID 159880833) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is N-ethylacetamide;1H-pyrazole.
Molecular Properties
| Compound Name | N-ethylacetamide;1H-pyrazole |
| PubChem CID | 159880833 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-ethylacetamide;1H-pyrazole |
| SMILES | CCNC(C)=O.c1cn[nH]c1 |
| InChI | InChI=1S/C4H9NO.C3H4N2/c1-3-5-4(2)6;1-2-4-5-3-1/h3H2,1-2H3,(H,5,6);1-3H,(H,4,5) |
| InChIKey | NTMQNZPCBMEGST-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethylacetamide;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylacetamide;1H-pyrazole?
The IUPAC name of N-ethylacetamide;1H-pyrazole (CID 159880833) is N-ethylacetamide;1H-pyrazole.
What is the SMILES notation for N-ethylacetamide;1H-pyrazole?
The canonical SMILES for N-ethylacetamide;1H-pyrazole is CCNC(C)=O.c1cn[nH]c1.
What is the InChIKey of N-ethylacetamide;1H-pyrazole?
The InChIKey is NTMQNZPCBMEGST-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C3H4N2/c1-3-5-4(2)6;1-2-4-5-3-1/h3H2,1-2H3,(H,5,6);1-3H,(H,4,5).
What are the key properties of N-ethylacetamide;1H-pyrazole?
N-ethylacetamide;1H-pyrazole has a molecular weight of 155.20 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylacetamide;1H-pyrazole is sourced from PubChem (CID 159880833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).